C11H20Cl3N3 — CID 162422883
N-(piperidin-4-ylmethyl)pyridin-2-amine;trihydrochloride (PubChem CID 162422883) has the molecular formula C11H20Cl3N3 and a molecular weight of 300.66 g/mol. Its IUPAC name is N-(piperidin-4-ylmethyl)pyridin-2-amine;trihydrochloride.
| Compound Name | N-(piperidin-4-ylmethyl)pyridin-2-amine;trihydrochloride |
|---|---|
| PubChem CID | 162422883 |
| Molecular Formula | C11H20Cl3N3 |
| Molecular Weight | 300.66 g/mol |
| Exact Mass | 299.07 |
| IUPAC Name | N-(piperidin-4-ylmethyl)pyridin-2-amine;trihydrochloride |
| SMILES | Cl.Cl.Cl.c1ccc(NCC2CCNCC2)nc1 |
| InChI | InChI=1S/C11H17N3.3ClH/c1-2-6-13-11(3-1)14-9-10-4-7-12-8-5-10;;;/h1-3,6,10,12H,4-5,7-9H2,(H,13,14);3*1H |
| InChIKey | SWDJIHRREYTFNO-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.66 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |