C11H18N4 — CID 117044535
2-N-(piperidin-4-ylmethyl)pyridine-2,5-diamine (PubChem CID 117044535) has the molecular formula C11H18N4 and a molecular weight of 206.29 g/mol. Its IUPAC name is 2-N-(piperidin-4-ylmethyl)pyridine-2,5-diamine.
| Compound Name | 2-N-(piperidin-4-ylmethyl)pyridine-2,5-diamine |
|---|---|
| PubChem CID | 117044535 |
| Molecular Formula | C11H18N4 |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.15 |
| IUPAC Name | 2-N-(piperidin-4-ylmethyl)pyridine-2,5-diamine |
| SMILES | Nc1ccc(NCC2CCNCC2)nc1 |
| InChI | InChI=1S/C11H18N4/c12-10-1-2-11(15-8-10)14-7-9-3-5-13-6-4-9/h1-2,8-9,13H,3-7,12H2,(H,14,15) |
| InChIKey | TUDPOCSNKMGCRJ-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 62.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |