C13H21N3 — CID 83837473
5-methyl-N-(2-piperidin-4-ylethyl)pyridin-2-amine (PubChem CID 83837473) has the molecular formula C13H21N3 and a molecular weight of 219.33 g/mol. Its IUPAC name is 5-methyl-N-(2-piperidin-4-ylethyl)pyridin-2-amine.
| Compound Name | 5-methyl-N-(2-piperidin-4-ylethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 83837473 |
| Molecular Formula | C13H21N3 |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.17 |
| IUPAC Name | 5-methyl-N-(2-piperidin-4-ylethyl)pyridin-2-amine |
| SMILES | Cc1ccc(NCCC2CCNCC2)nc1 |
| InChI | InChI=1S/C13H21N3/c1-11-2-3-13(16-10-11)15-9-6-12-4-7-14-8-5-12/h2-3,10,12,14H,4-9H2,1H3,(H,15,16) |
| InChIKey | GIFZNEQXBFYALG-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |