C11H19N3O — CID 112710219
5-methyl-N-(2-piperidin-4-ylethyl)-1,3-oxazol-2-amine (PubChem CID 112710219) has the molecular formula C11H19N3O and a molecular weight of 209.29 g/mol. Its IUPAC name is 5-methyl-N-(2-piperidin-4-ylethyl)-1,3-oxazol-2-amine.
| Compound Name | 5-methyl-N-(2-piperidin-4-ylethyl)-1,3-oxazol-2-amine |
|---|---|
| PubChem CID | 112710219 |
| Molecular Formula | C11H19N3O |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.15 |
| IUPAC Name | 5-methyl-N-(2-piperidin-4-ylethyl)-1,3-oxazol-2-amine |
| SMILES | Cc1cnc(NCCC2CCNCC2)o1 |
| InChI | InChI=1S/C11H19N3O/c1-9-8-14-11(15-9)13-7-4-10-2-5-12-6-3-10/h8,10,12H,2-7H2,1H3,(H,13,14) |
| InChIKey | PUBZWODLCMVZDD-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 50.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |