C12H22N4 — CID 103568968
2,5-dimethyl-N-(2-piperidin-4-ylethyl)pyrazol-3-amine (PubChem CID 103568968) has the molecular formula C12H22N4 and a molecular weight of 222.34 g/mol. Its IUPAC name is 2,5-dimethyl-N-(2-piperidin-4-ylethyl)pyrazol-3-amine.
| Compound Name | 2,5-dimethyl-N-(2-piperidin-4-ylethyl)pyrazol-3-amine |
|---|---|
| PubChem CID | 103568968 |
| Molecular Formula | C12H22N4 |
| Molecular Weight | 222.34 g/mol |
| Exact Mass | 222.18 |
| IUPAC Name | 2,5-dimethyl-N-(2-piperidin-4-ylethyl)pyrazol-3-amine |
| SMILES | Cc1cc(NCCC2CCNCC2)n(C)n1 |
| InChI | InChI=1S/C12H22N4/c1-10-9-12(16(2)15-10)14-8-5-11-3-6-13-7-4-11/h9,11,13-14H,3-8H2,1-2H3 |
| InChIKey | VZPPRYVEJYBAOA-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 41.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.34 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |