C12H22N4 — CID 103568966
N-[(4-aminocyclohexyl)methyl]-2,5-dimethylpyrazol-3-amine (PubChem CID 103568966) has the molecular formula C12H22N4 and a molecular weight of 222.34 g/mol. Its IUPAC name is N-[(4-aminocyclohexyl)methyl]-2,5-dimethylpyrazol-3-amine.
| Compound Name | N-[(4-aminocyclohexyl)methyl]-2,5-dimethylpyrazol-3-amine |
|---|---|
| PubChem CID | 103568966 |
| Molecular Formula | C12H22N4 |
| Molecular Weight | 222.34 g/mol |
| Exact Mass | 222.18 |
| IUPAC Name | N-[(4-aminocyclohexyl)methyl]-2,5-dimethylpyrazol-3-amine |
| SMILES | Cc1cc(NCC2CCC(N)CC2)n(C)n1 |
| InChI | InChI=1S/C12H22N4/c1-9-7-12(16(2)15-9)14-8-10-3-5-11(13)6-4-10/h7,10-11,14H,3-6,8,13H2,1-2H3 |
| InChIKey | FKUQHMXSPPECMP-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.34 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |