C15H26N4 — CID 103569096
N-(1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-2-ylmethyl)-2,5-dimethylpyrazol-3-amine (PubChem CID 103569096) has the molecular formula C15H26N4 and a molecular weight of 262.40 g/mol. Its IUPAC name is N-(1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-2-ylmethyl)-2,5-dimethylpyrazol-3-amine.
| Compound Name | N-(1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-2-ylmethyl)-2,5-dimethylpyrazol-3-amine |
|---|---|
| PubChem CID | 103569096 |
| Molecular Formula | C15H26N4 |
| Molecular Weight | 262.40 g/mol |
| Exact Mass | 262.22 |
| IUPAC Name | N-(1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-2-ylmethyl)-2,5-dimethylpyrazol-3-amine |
| SMILES | Cc1cc(NCC2CCC3CCCCC3N2)n(C)n1 |
| InChI | InChI=1S/C15H26N4/c1-11-9-15(19(2)18-11)16-10-13-8-7-12-5-3-4-6-14(12)17-13/h9,12-14,16-17H,3-8,10H2,1-2H3 |
| InChIKey | ZYSBWVNCYZPPSD-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 41.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.40 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |