C13H18N2O — CID 157157680
cyclopropanecarbaldehyde;N-(cyclopropylmethyl)pyridin-2-amine (PubChem CID 157157680) has the molecular formula C13H18N2O and a molecular weight of 218.30 g/mol. Its IUPAC name is cyclopropanecarbaldehyde;N-(cyclopropylmethyl)pyridin-2-amine.
| Compound Name | cyclopropanecarbaldehyde;N-(cyclopropylmethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 157157680 |
| Molecular Formula | C13H18N2O |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.14 |
| IUPAC Name | cyclopropanecarbaldehyde;N-(cyclopropylmethyl)pyridin-2-amine |
| SMILES | O=CC1CC1.c1ccc(NCC2CC2)nc1 |
| InChI | InChI=1S/C9H12N2.C4H6O/c1-2-6-10-9(3-1)11-7-8-4-5-8;5-3-4-1-2-4/h1-3,6,8H,4-5,7H2,(H,10,11);3-4H,1-2H2 |
| InChIKey | ALZVLXAFIPNJPY-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|