C11H18N4 — CID 133269613
N-[(3,5-dimethylpyrazolidin-4-yl)methyl]pyridin-2-amine (PubChem CID 133269613) has the molecular formula C11H18N4 and a molecular weight of 206.29 g/mol. Its IUPAC name is N-[(3,5-dimethylpyrazolidin-4-yl)methyl]pyridin-2-amine.
| Compound Name | N-[(3,5-dimethylpyrazolidin-4-yl)methyl]pyridin-2-amine |
|---|---|
| PubChem CID | 133269613 |
| Molecular Formula | C11H18N4 |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.15 |
| IUPAC Name | N-[(3,5-dimethylpyrazolidin-4-yl)methyl]pyridin-2-amine |
| SMILES | CC1NNC(C)C1CNc1ccccn1 |
| InChI | InChI=1S/C11H18N4/c1-8-10(9(2)15-14-8)7-13-11-5-3-4-6-12-11/h3-6,8-10,14-15H,7H2,1-2H3,(H,12,13) |
| InChIKey | PSRKSRNTEJRMGQ-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 48.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |