C13H21N3 — CID 115213588
N-[[4-(methylamino)cyclohexyl]methyl]pyridin-2-amine (PubChem CID 115213588) has the molecular formula C13H21N3 and a molecular weight of 219.33 g/mol. Its IUPAC name is N-[[4-(methylamino)cyclohexyl]methyl]pyridin-2-amine.
| Compound Name | N-[[4-(methylamino)cyclohexyl]methyl]pyridin-2-amine |
|---|---|
| PubChem CID | 115213588 |
| Molecular Formula | C13H21N3 |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.17 |
| IUPAC Name | N-[[4-(methylamino)cyclohexyl]methyl]pyridin-2-amine |
| SMILES | CNC1CCC(CNc2ccccn2)CC1 |
| InChI | InChI=1S/C13H21N3/c1-14-12-7-5-11(6-8-12)10-16-13-4-2-3-9-15-13/h2-4,9,11-12,14H,5-8,10H2,1H3,(H,15,16) |
| InChIKey | BVTJLPDHJQVMHA-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |