About 1,3-dimethylpyrrolidine;N-methyl-N'-pyridin-2-ylmethanediamine
1,3-dimethylpyrrolidine;N-methyl-N'-pyridin-2-ylmethanediamine (PubChem CID 143564879) has the molecular formula C13H24N4
and a molecular weight of 236.36 g/mol. Its IUPAC name is 1,3-dimethylpyrrolidine;N-methyl-N'-pyridin-2-ylmethanediamine.
Molecular Properties
| Compound Name | 1,3-dimethylpyrrolidine;N-methyl-N'-pyridin-2-ylmethanediamine |
| PubChem CID | 143564879 |
| Molecular Formula | C13H24N4 |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.20 |
| IUPAC Name | 1,3-dimethylpyrrolidine;N-methyl-N'-pyridin-2-ylmethanediamine |
| SMILES | CC1CCN(C)C1.CNCNc1ccccn1 |
| InChI | InChI=1S/C7H11N3.C6H13N/c1-8-6-10-7-4-2-3-5-9-7;1-6-3-4-7(2)5-6/h2-5,8H,6H2,1H3,(H,9,10);6H,3-5H2,1-2H3 |
| InChIKey | IZWMSXRUKNVLAJ-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 40.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1,3-dimethylpyrrolidine;N-methyl-N'-pyridin-2-ylmethanediamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dimethylpyrrolidine;N-methyl-N'-pyridin-2-ylmethanediamine?
The IUPAC name of 1,3-dimethylpyrrolidine;N-methyl-N'-pyridin-2-ylmethanediamine (CID 143564879) is 1,3-dimethylpyrrolidine;N-methyl-N'-pyridin-2-ylmethanediamine.
What is the SMILES notation for 1,3-dimethylpyrrolidine;N-methyl-N'-pyridin-2-ylmethanediamine?
The canonical SMILES for 1,3-dimethylpyrrolidine;N-methyl-N'-pyridin-2-ylmethanediamine is CC1CCN(C)C1.CNCNc1ccccn1.
What is the InChIKey of 1,3-dimethylpyrrolidine;N-methyl-N'-pyridin-2-ylmethanediamine?
The InChIKey is IZWMSXRUKNVLAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11N3.C6H13N/c1-8-6-10-7-4-2-3-5-9-7;1-6-3-4-7(2)5-6/h2-5,8H,6H2,1H3,(H,9,10);6H,3-5H2,1-2H3.
What are the key properties of 1,3-dimethylpyrrolidine;N-methyl-N'-pyridin-2-ylmethanediamine?
1,3-dimethylpyrrolidine;N-methyl-N'-pyridin-2-ylmethanediamine has a molecular weight of 236.36 g/mol, XLogP of 1.63, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dimethylpyrrolidine;N-methyl-N'-pyridin-2-ylmethanediamine is sourced from PubChem (CID 143564879), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).