C24H38N8 — CID 118449962
2-N-butyl-4-N-cyclohexyl-5-[6-[(1-methylpiperidin-4-yl)amino]pyrimidin-4-yl]pyrimidine-2,4-diamine (PubChem CID 118449962) has the molecular formula C24H38N8 and a molecular weight of 438.62 g/mol. Its IUPAC name is 2-N-butyl-4-N-cyclohexyl-5-[6-[(1-methylpiperidin-4-yl)amino]pyrimidin-4-yl]pyrimidine-2,4-diamine.
| Compound Name | 2-N-butyl-4-N-cyclohexyl-5-[6-[(1-methylpiperidin-4-yl)amino]pyrimidin-4-yl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 118449962 |
| Molecular Formula | C24H38N8 |
| Molecular Weight | 438.62 g/mol |
| Exact Mass | 438.32 |
| IUPAC Name | 2-N-butyl-4-N-cyclohexyl-5-[6-[(1-methylpiperidin-4-yl)amino]pyrimidin-4-yl]pyrimidine-2,4-diamine |
| SMILES | CCCCNc1ncc(-c2cc(NC3CCN(C)CC3)ncn2)c(NC2CCCCC2)n1 |
| InChI | InChI=1S/C24H38N8/c1-3-4-12-25-24-26-16-20(23(31-24)30-18-8-6-5-7-9-18)21-15-22(28-17-27-21)29-19-10-13-32(2)14-11-19/h15-19H,3-14H2,1-2H3,(H,27,28,29)(H2,25,26,30,31) |
| InChIKey | CSZCZJPYVXANGE-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 90.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.62 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|