C23H36N6 — CID 137419886
2-N-butyl-8-cyclohexyl-5-N-(1-methylpiperidin-4-yl)pyrido[4,3-d]pyrimidine-2,5-diamine (PubChem CID 137419886) has the molecular formula C23H36N6 and a molecular weight of 396.58 g/mol. Its IUPAC name is 2-N-butyl-8-cyclohexyl-5-N-(1-methylpiperidin-4-yl)pyrido[4,3-d]pyrimidine-2,5-diamine.
| Compound Name | 2-N-butyl-8-cyclohexyl-5-N-(1-methylpiperidin-4-yl)pyrido[4,3-d]pyrimidine-2,5-diamine |
|---|---|
| PubChem CID | 137419886 |
| Molecular Formula | C23H36N6 |
| Molecular Weight | 396.58 g/mol |
| Exact Mass | 396.30 |
| IUPAC Name | 2-N-butyl-8-cyclohexyl-5-N-(1-methylpiperidin-4-yl)pyrido[4,3-d]pyrimidine-2,5-diamine |
| SMILES | CCCCNc1ncc2c(NC3CCN(C)CC3)ncc(C3CCCCC3)c2n1 |
| InChI | InChI=1S/C23H36N6/c1-3-4-12-24-23-26-16-20-21(28-23)19(17-8-6-5-7-9-17)15-25-22(20)27-18-10-13-29(2)14-11-18/h15-18H,3-14H2,1-2H3,(H,25,27)(H,24,26,28) |
| InChIKey | ZUEYZHALQALITK-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 65.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.58 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|