C23H37N5O2 — CID 142517818
N-butyl-5-(1-methylpiperidin-4-yl)oxypyrido[4,3-d]pyrimidin-2-amine;cyclohexanol (PubChem CID 142517818) has the molecular formula C23H37N5O2 and a molecular weight of 415.58 g/mol. Its IUPAC name is N-butyl-5-(1-methylpiperidin-4-yl)oxypyrido[4,3-d]pyrimidin-2-amine;cyclohexanol.
| Compound Name | N-butyl-5-(1-methylpiperidin-4-yl)oxypyrido[4,3-d]pyrimidin-2-amine;cyclohexanol |
|---|---|
| PubChem CID | 142517818 |
| Molecular Formula | C23H37N5O2 |
| Molecular Weight | 415.58 g/mol |
| Exact Mass | 415.29 |
| IUPAC Name | N-butyl-5-(1-methylpiperidin-4-yl)oxypyrido[4,3-d]pyrimidin-2-amine;cyclohexanol |
| SMILES | CCCCNc1ncc2c(OC3CCN(C)CC3)nccc2n1.OC1CCCCC1 |
| InChI | InChI=1S/C17H25N5O.C6H12O/c1-3-4-8-19-17-20-12-14-15(21-17)5-9-18-16(14)23-13-6-10-22(2)11-7-13;7-6-4-2-1-3-5-6/h5,9,12-13H,3-4,6-8,10-11H2,1-2H3,(H,19,20,21);6-7H,1-5H2 |
| InChIKey | LBMQVEVDGBINRM-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 83.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.58 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|