About N-butyl-5-(1-methylpiperidin-4-yl)oxypyrido[4,3-d]pyrimidin-2-amine;cyclohexanol
N-butyl-5-(1-methylpiperidin-4-yl)oxypyrido[4,3-d]pyrimidin-2-amine;cyclohexanol (PubChem CID 142517818) has the molecular formula C23H37N5O2
and a molecular weight of 415.58 g/mol. Its IUPAC name is N-butyl-5-(1-methylpiperidin-4-yl)oxypyrido[4,3-d]pyrimidin-2-amine;cyclohexanol.
Molecular Properties
| Compound Name | N-butyl-5-(1-methylpiperidin-4-yl)oxypyrido[4,3-d]pyrimidin-2-amine;cyclohexanol |
| PubChem CID | 142517818 |
| Molecular Formula | C23H37N5O2 |
| Molecular Weight | 415.58 g/mol |
| Exact Mass | 415.29 |
| IUPAC Name | N-butyl-5-(1-methylpiperidin-4-yl)oxypyrido[4,3-d]pyrimidin-2-amine;cyclohexanol |
| SMILES | CCCCNc1ncc2c(OC3CCN(C)CC3)nccc2n1.OC1CCCCC1 |
| InChI | InChI=1S/C17H25N5O.C6H12O/c1-3-4-8-19-17-20-12-14-15(21-17)5-9-18-16(14)23-13-6-10-22(2)11-7-13;7-6-4-2-1-3-5-6/h5,9,12-13H,3-4,6-8,10-11H2,1-2H3,(H,19,20,21);6-7H,1-5H2 |
| InChIKey | LBMQVEVDGBINRM-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 83.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 415.58 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-butyl-5-(1-methylpiperidin-4-yl)oxypyrido[4,3-d]pyrimidin-2-amine;cyclohexanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butyl-5-(1-methylpiperidin-4-yl)oxypyrido[4,3-d]pyrimidin-2-amine;cyclohexanol?
The IUPAC name of N-butyl-5-(1-methylpiperidin-4-yl)oxypyrido[4,3-d]pyrimidin-2-amine;cyclohexanol (CID 142517818) is N-butyl-5-(1-methylpiperidin-4-yl)oxypyrido[4,3-d]pyrimidin-2-amine;cyclohexanol.
What is the SMILES notation for N-butyl-5-(1-methylpiperidin-4-yl)oxypyrido[4,3-d]pyrimidin-2-amine;cyclohexanol?
The canonical SMILES for N-butyl-5-(1-methylpiperidin-4-yl)oxypyrido[4,3-d]pyrimidin-2-amine;cyclohexanol is CCCCNc1ncc2c(OC3CCN(C)CC3)nccc2n1.OC1CCCCC1.
What is the InChIKey of N-butyl-5-(1-methylpiperidin-4-yl)oxypyrido[4,3-d]pyrimidin-2-amine;cyclohexanol?
The InChIKey is LBMQVEVDGBINRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H25N5O.C6H12O/c1-3-4-8-19-17-20-12-14-15(21-17)5-9-18-16(14)23-13-6-10-22(2)11-7-13;7-6-4-2-1-3-5-6/h5,9,12-13H,3-4,6-8,10-11H2,1-2H3,(H,19,20,21);6-7H,1-5H2.
What are the key properties of N-butyl-5-(1-methylpiperidin-4-yl)oxypyrido[4,3-d]pyrimidin-2-amine;cyclohexanol?
N-butyl-5-(1-methylpiperidin-4-yl)oxypyrido[4,3-d]pyrimidin-2-amine;cyclohexanol has a molecular weight of 415.58 g/mol, XLogP of 4.02, 6 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-butyl-5-(1-methylpiperidin-4-yl)oxypyrido[4,3-d]pyrimidin-2-amine;cyclohexanol is sourced from PubChem (CID 142517818), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).