C26H45N5O — CID 153365818
4-[[2-(butylamino)-5-[1-(cyclohexylmethyl)piperidin-4-yl]pyrimidin-4-yl]amino]cyclohexan-1-ol (PubChem CID 153365818) has the molecular formula C26H45N5O and a molecular weight of 443.68 g/mol. Its IUPAC name is 4-[[2-(butylamino)-5-[1-(cyclohexylmethyl)piperidin-4-yl]pyrimidin-4-yl]amino]cyclohexan-1-ol.
| Compound Name | 4-[[2-(butylamino)-5-[1-(cyclohexylmethyl)piperidin-4-yl]pyrimidin-4-yl]amino]cyclohexan-1-ol |
|---|---|
| PubChem CID | 153365818 |
| Molecular Formula | C26H45N5O |
| Molecular Weight | 443.68 g/mol |
| Exact Mass | 443.36 |
| IUPAC Name | 4-[[2-(butylamino)-5-[1-(cyclohexylmethyl)piperidin-4-yl]pyrimidin-4-yl]amino]cyclohexan-1-ol |
| SMILES | CCCCNc1ncc(C2CCN(CC3CCCCC3)CC2)c(NC2CCC(O)CC2)n1 |
| InChI | InChI=1S/C26H45N5O/c1-2-3-15-27-26-28-18-24(25(30-26)29-22-9-11-23(32)12-10-22)21-13-16-31(17-14-21)19-20-7-5-4-6-8-20/h18,20-23,32H,2-17,19H2,1H3,(H2,27,28,29,30) |
| InChIKey | UXOSHYOOCQIVMO-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 73.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.68 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|