C16H23BrN4 — CID 148972465
5-bromo-N-butyl-7-cyclohexylpyrrolo[2,3-d]pyrimidin-2-amine (PubChem CID 148972465) has the molecular formula C16H23BrN4 and a molecular weight of 351.29 g/mol. Its IUPAC name is 5-bromo-N-butyl-7-cyclohexylpyrrolo[2,3-d]pyrimidin-2-amine.
| Compound Name | 5-bromo-N-butyl-7-cyclohexylpyrrolo[2,3-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 148972465 |
| Molecular Formula | C16H23BrN4 |
| Molecular Weight | 351.29 g/mol |
| Exact Mass | 350.11 |
| IUPAC Name | 5-bromo-N-butyl-7-cyclohexylpyrrolo[2,3-d]pyrimidin-2-amine |
| SMILES | CCCCNc1ncc2c(Br)cn(C3CCCCC3)c2n1 |
| InChI | InChI=1S/C16H23BrN4/c1-2-3-9-18-16-19-10-13-14(17)11-21(15(13)20-16)12-7-5-4-6-8-12/h10-12H,2-9H2,1H3,(H,18,19,20) |
| InChIKey | PUDKSTGKDWDHPK-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.29 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|