C21H25ClN4O — CID 145439602
3-(butylamino)-8-chloro-5-cyclohexylpyrimido[4,5-c]isoquinolin-6-one (PubChem CID 145439602) has the molecular formula C21H25ClN4O and a molecular weight of 384.91 g/mol. Its IUPAC name is 3-(butylamino)-8-chloro-5-cyclohexylpyrimido[4,5-c]isoquinolin-6-one.
| Compound Name | 3-(butylamino)-8-chloro-5-cyclohexylpyrimido[4,5-c]isoquinolin-6-one |
|---|---|
| PubChem CID | 145439602 |
| Molecular Formula | C21H25ClN4O |
| Molecular Weight | 384.91 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | 3-(butylamino)-8-chloro-5-cyclohexylpyrimido[4,5-c]isoquinolin-6-one |
| SMILES | CCCCNc1ncc2c3ccc(Cl)cc3c(=O)n(C3CCCCC3)c2n1 |
| InChI | InChI=1S/C21H25ClN4O/c1-2-3-11-23-21-24-13-18-16-10-9-14(22)12-17(16)20(27)26(19(18)25-21)15-7-5-4-6-8-15/h9-10,12-13,15H,2-8,11H2,1H3,(H,23,24,25) |
| InChIKey | OERPFLLQBGDAFS-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.91 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|