C28H38N6O3 — CID 134163804
3-(butylamino)-5-(4-hydroxycyclohexyl)-8-[4-(oxetan-3-yl)piperazin-1-yl]pyrimido[4,5-c]isoquinolin-6-one (PubChem CID 134163804) has the molecular formula C28H38N6O3 and a molecular weight of 506.65 g/mol. Its IUPAC name is 3-(butylamino)-5-(4-hydroxycyclohexyl)-8-[4-(oxetan-3-yl)piperazin-1-yl]pyrimido[4,5-c]isoquinolin-6-one.
| Compound Name | 3-(butylamino)-5-(4-hydroxycyclohexyl)-8-[4-(oxetan-3-yl)piperazin-1-yl]pyrimido[4,5-c]isoquinolin-6-one |
|---|---|
| PubChem CID | 134163804 |
| Molecular Formula | C28H38N6O3 |
| Molecular Weight | 506.65 g/mol |
| Exact Mass | 506.30 |
| IUPAC Name | 3-(butylamino)-5-(4-hydroxycyclohexyl)-8-[4-(oxetan-3-yl)piperazin-1-yl]pyrimido[4,5-c]isoquinolin-6-one |
| SMILES | CCCCNc1ncc2c3ccc(N4CCN(C5COC5)CC4)cc3c(=O)n(C3CCC(O)CC3)c2n1 |
| InChI | InChI=1S/C28H38N6O3/c1-2-3-10-29-28-30-16-25-23-9-6-20(32-11-13-33(14-12-32)21-17-37-18-21)15-24(23)27(36)34(26(25)31-28)19-4-7-22(35)8-5-19/h6,9,15-16,19,21-22,35H,2-5,7-8,10-14,17-18H2,1H3,(H,29,30,31) |
| InChIKey | AJJULNUGBXUJNC-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 95.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.65 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|