C27H36F2N6O2 — CID 134163784
3-(2,2-difluorobutylamino)-5-(4-hydroxycyclohexyl)-8-[(4-methylpiperazin-1-yl)methyl]pyrimido[4,5-c]isoquinolin-6-one (PubChem CID 134163784) has the molecular formula C27H36F2N6O2 and a molecular weight of 514.62 g/mol. Its IUPAC name is 3-(2,2-difluorobutylamino)-5-(4-hydroxycyclohexyl)-8-[(4-methylpiperazin-1-yl)methyl]pyrimido[4,5-c]isoquinolin-6-one.
| Compound Name | 3-(2,2-difluorobutylamino)-5-(4-hydroxycyclohexyl)-8-[(4-methylpiperazin-1-yl)methyl]pyrimido[4,5-c]isoquinolin-6-one |
|---|---|
| PubChem CID | 134163784 |
| Molecular Formula | C27H36F2N6O2 |
| Molecular Weight | 514.62 g/mol |
| Exact Mass | 514.29 |
| IUPAC Name | 3-(2,2-difluorobutylamino)-5-(4-hydroxycyclohexyl)-8-[(4-methylpiperazin-1-yl)methyl]pyrimido[4,5-c]isoquinolin-6-one |
| SMILES | CCC(F)(F)CNc1ncc2c3ccc(CN4CCN(C)CC4)cc3c(=O)n(C3CCC(O)CC3)c2n1 |
| InChI | InChI=1S/C27H36F2N6O2/c1-3-27(28,29)17-31-26-30-15-23-21-9-4-18(16-34-12-10-33(2)11-13-34)14-22(21)25(37)35(24(23)32-26)19-5-7-20(36)8-6-19/h4,9,14-15,19-20,36H,3,5-8,10-13,16-17H2,1-2H3,(H,30,31,32) |
| InChIKey | QTNNDKSSQGYACK-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 86.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.62 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|