C27H35FN6O2 — CID 134163785
3-[(3-fluorocyclobutyl)amino]-5-(4-hydroxycyclohexyl)-8-[(4-methylpiperazin-1-yl)methyl]pyrimido[4,5-c]isoquinolin-6-one (PubChem CID 134163785) has the molecular formula C27H35FN6O2 and a molecular weight of 494.62 g/mol. Its IUPAC name is 3-[(3-fluorocyclobutyl)amino]-5-(4-hydroxycyclohexyl)-8-[(4-methylpiperazin-1-yl)methyl]pyrimido[4,5-c]isoquinolin-6-one.
| Compound Name | 3-[(3-fluorocyclobutyl)amino]-5-(4-hydroxycyclohexyl)-8-[(4-methylpiperazin-1-yl)methyl]pyrimido[4,5-c]isoquinolin-6-one |
|---|---|
| PubChem CID | 134163785 |
| Molecular Formula | C27H35FN6O2 |
| Molecular Weight | 494.62 g/mol |
| Exact Mass | 494.28 |
| IUPAC Name | 3-[(3-fluorocyclobutyl)amino]-5-(4-hydroxycyclohexyl)-8-[(4-methylpiperazin-1-yl)methyl]pyrimido[4,5-c]isoquinolin-6-one |
| SMILES | CN1CCN(Cc2ccc3c(c2)c(=O)n(C2CCC(O)CC2)c2nc(NC4CC(F)C4)ncc32)CC1 |
| InChI | InChI=1S/C27H35FN6O2/c1-32-8-10-33(11-9-32)16-17-2-7-22-23(12-17)26(36)34(20-3-5-21(35)6-4-20)25-24(22)15-29-27(31-25)30-19-13-18(28)14-19/h2,7,12,15,18-21,35H,3-6,8-11,13-14,16H2,1H3,(H,29,30,31) |
| InChIKey | KTRXKYSDSBZSQB-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 86.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.62 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|