C23H30N6O2 — CID 134163778
3-amino-5-(4-hydroxycyclohexyl)-8-[(4-methylpiperazin-1-yl)methyl]pyrimido[4,5-c]isoquinolin-6-one (PubChem CID 134163778) has the molecular formula C23H30N6O2 and a molecular weight of 422.53 g/mol. Its IUPAC name is 3-amino-5-(4-hydroxycyclohexyl)-8-[(4-methylpiperazin-1-yl)methyl]pyrimido[4,5-c]isoquinolin-6-one.
| Compound Name | 3-amino-5-(4-hydroxycyclohexyl)-8-[(4-methylpiperazin-1-yl)methyl]pyrimido[4,5-c]isoquinolin-6-one |
|---|---|
| PubChem CID | 134163778 |
| Molecular Formula | C23H30N6O2 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.24 |
| IUPAC Name | 3-amino-5-(4-hydroxycyclohexyl)-8-[(4-methylpiperazin-1-yl)methyl]pyrimido[4,5-c]isoquinolin-6-one |
| SMILES | CN1CCN(Cc2ccc3c(c2)c(=O)n(C2CCC(O)CC2)c2nc(N)ncc32)CC1 |
| InChI | InChI=1S/C23H30N6O2/c1-27-8-10-28(11-9-27)14-15-2-7-18-19(12-15)22(31)29(16-3-5-17(30)6-4-16)21-20(18)13-25-23(24)26-21/h2,7,12-13,16-17,30H,3-6,8-11,14H2,1H3,(H2,24,25,26) |
| InChIKey | BKJOTFKVFFCPJX-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 100.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|