C32H39N7O — CID 166723890
3-(cyclopropylmethylamino)-5-(4-methylcyclohexyl)-8-[(4-pyridin-4-ylpiperazin-1-yl)methyl]pyrimido[4,5-c]isoquinolin-6-one (PubChem CID 166723890) has the molecular formula C32H39N7O and a molecular weight of 537.71 g/mol. Its IUPAC name is 3-(cyclopropylmethylamino)-5-(4-methylcyclohexyl)-8-[(4-pyridin-4-ylpiperazin-1-yl)methyl]pyrimido[4,5-c]isoquinolin-6-one.
| Compound Name | 3-(cyclopropylmethylamino)-5-(4-methylcyclohexyl)-8-[(4-pyridin-4-ylpiperazin-1-yl)methyl]pyrimido[4,5-c]isoquinolin-6-one |
|---|---|
| PubChem CID | 166723890 |
| Molecular Formula | C32H39N7O |
| Molecular Weight | 537.71 g/mol |
| Exact Mass | 537.32 |
| IUPAC Name | 3-(cyclopropylmethylamino)-5-(4-methylcyclohexyl)-8-[(4-pyridin-4-ylpiperazin-1-yl)methyl]pyrimido[4,5-c]isoquinolin-6-one |
| SMILES | CC1CCC(n2c(=O)c3cc(CN4CCN(c5ccncc5)CC4)ccc3c3cnc(NCC4CC4)nc32)CC1 |
| InChI | InChI=1S/C32H39N7O/c1-22-2-7-26(8-3-22)39-30-29(20-35-32(36-30)34-19-23-4-5-23)27-9-6-24(18-28(27)31(39)40)21-37-14-16-38(17-15-37)25-10-12-33-13-11-25/h6,9-13,18,20,22-23,26H,2-5,7-8,14-17,19,21H2,1H3,(H,34,35,36) |
| InChIKey | HEVSIUBGKHOEIW-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 79.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.71 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|