C29H38N6O2 — CID 134163980
8-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-ylmethyl)-3-(cyclopropylmethylamino)-5-(4-hydroxycyclohexyl)pyrimido[4,5-c]isoquinolin-6-one (PubChem CID 134163980) has the molecular formula C29H38N6O2 and a molecular weight of 502.66 g/mol. Its IUPAC name is 8-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-ylmethyl)-3-(cyclopropylmethylamino)-5-(4-hydroxycyclohexyl)pyrimido[4,5-c]isoquinolin-6-one.
| Compound Name | 8-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-ylmethyl)-3-(cyclopropylmethylamino)-5-(4-hydroxycyclohexyl)pyrimido[4,5-c]isoquinolin-6-one |
|---|---|
| PubChem CID | 134163980 |
| Molecular Formula | C29H38N6O2 |
| Molecular Weight | 502.66 g/mol |
| Exact Mass | 502.31 |
| IUPAC Name | 8-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-ylmethyl)-3-(cyclopropylmethylamino)-5-(4-hydroxycyclohexyl)pyrimido[4,5-c]isoquinolin-6-one |
| SMILES | O=c1c2cc(CN3CCN4CCCC4C3)ccc2c2cnc(NCC3CC3)nc2n1C1CCC(O)CC1 |
| InChI | InChI=1S/C29H38N6O2/c36-23-8-6-21(7-9-23)35-27-26(16-31-29(32-27)30-15-19-3-4-19)24-10-5-20(14-25(24)28(35)37)17-33-12-13-34-11-1-2-22(34)18-33/h5,10,14,16,19,21-23,36H,1-4,6-9,11-13,15,17-18H2,(H,30,31,32) |
| InChIKey | AOEZWLWTJWCDDC-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 86.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.66 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|