C28H39N7O3 — CID 138504125
[4-[[3-(butylamino)-8-(4-methylpiperazin-1-yl)-6-oxopyrimido[4,5-c]isoquinolin-5-yl]methyl]cyclohexyl] carbamate (PubChem CID 138504125) has the molecular formula C28H39N7O3 and a molecular weight of 521.67 g/mol. Its IUPAC name is [4-[[3-(butylamino)-8-(4-methylpiperazin-1-yl)-6-oxopyrimido[4,5-c]isoquinolin-5-yl]methyl]cyclohexyl] carbamate.
| Compound Name | [4-[[3-(butylamino)-8-(4-methylpiperazin-1-yl)-6-oxopyrimido[4,5-c]isoquinolin-5-yl]methyl]cyclohexyl] carbamate |
|---|---|
| PubChem CID | 138504125 |
| Molecular Formula | C28H39N7O3 |
| Molecular Weight | 521.67 g/mol |
| Exact Mass | 521.31 |
| IUPAC Name | [4-[[3-(butylamino)-8-(4-methylpiperazin-1-yl)-6-oxopyrimido[4,5-c]isoquinolin-5-yl]methyl]cyclohexyl] carbamate |
| SMILES | CCCCNc1ncc2c3ccc(N4CCN(C)CC4)cc3c(=O)n(CC3CCC(OC(N)=O)CC3)c2n1 |
| InChI | InChI=1S/C28H39N7O3/c1-3-4-11-30-28-31-17-24-22-10-7-20(34-14-12-33(2)13-15-34)16-23(22)26(36)35(25(24)32-28)18-19-5-8-21(9-6-19)38-27(29)37/h7,10,16-17,19,21H,3-6,8-9,11-15,18H2,1-2H3,(H2,29,37)(H,30,31,32) |
| InChIKey | HNOSOBWMZZPGGT-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 118.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.67 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|