C26H36N6O2 — CID 138514403
3-(cyclopropylmethylamino)-5-[(3S)-1-hydroxyhexan-3-yl]-8-(4-methylpiperazin-1-yl)pyrimido[4,5-c]isoquinolin-6-one (PubChem CID 138514403) has the molecular formula C26H36N6O2 and a molecular weight of 464.61 g/mol. Its IUPAC name is 3-(cyclopropylmethylamino)-5-[(3S)-1-hydroxyhexan-3-yl]-8-(4-methylpiperazin-1-yl)pyrimido[4,5-c]isoquinolin-6-one.
| Compound Name | 3-(cyclopropylmethylamino)-5-[(3S)-1-hydroxyhexan-3-yl]-8-(4-methylpiperazin-1-yl)pyrimido[4,5-c]isoquinolin-6-one |
|---|---|
| PubChem CID | 138514403 |
| Molecular Formula | C26H36N6O2 |
| Molecular Weight | 464.61 g/mol |
| Exact Mass | 464.29 |
| IUPAC Name | 3-(cyclopropylmethylamino)-5-[(3S)-1-hydroxyhexan-3-yl]-8-(4-methylpiperazin-1-yl)pyrimido[4,5-c]isoquinolin-6-one |
| SMILES | CCC[C@@H](CCO)n1c(=O)c2cc(N3CCN(C)CC3)ccc2c2cnc(NCC3CC3)nc21 |
| InChI | InChI=1S/C26H36N6O2/c1-3-4-19(9-14-33)32-24-23(17-28-26(29-24)27-16-18-5-6-18)21-8-7-20(15-22(21)25(32)34)31-12-10-30(2)11-13-31/h7-8,15,17-19,33H,3-6,9-14,16H2,1-2H3,(H,27,28,29)/t19-/m0/s1 |
| InChIKey | IDLFCNHYTOMBKQ-IBGZPJMESA-N |
| XLogP | 3.24 |
| TPSA | 86.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.61 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|