C28H38N6O2 — CID 134163843
3-(2-cyclopropylethylamino)-5-(4-hydroxy-4-methylcyclohexyl)-8-(4-methylpiperazin-1-yl)pyrimido[4,5-c]isoquinolin-6-one (PubChem CID 134163843) has the molecular formula C28H38N6O2 and a molecular weight of 490.65 g/mol. Its IUPAC name is 3-(2-cyclopropylethylamino)-5-(4-hydroxy-4-methylcyclohexyl)-8-(4-methylpiperazin-1-yl)pyrimido[4,5-c]isoquinolin-6-one.
| Compound Name | 3-(2-cyclopropylethylamino)-5-(4-hydroxy-4-methylcyclohexyl)-8-(4-methylpiperazin-1-yl)pyrimido[4,5-c]isoquinolin-6-one |
|---|---|
| PubChem CID | 134163843 |
| Molecular Formula | C28H38N6O2 |
| Molecular Weight | 490.65 g/mol |
| Exact Mass | 490.31 |
| IUPAC Name | 3-(2-cyclopropylethylamino)-5-(4-hydroxy-4-methylcyclohexyl)-8-(4-methylpiperazin-1-yl)pyrimido[4,5-c]isoquinolin-6-one |
| SMILES | CN1CCN(c2ccc3c(c2)c(=O)n(C2CCC(C)(O)CC2)c2nc(NCCC4CC4)ncc32)CC1 |
| InChI | InChI=1S/C28H38N6O2/c1-28(36)10-7-20(8-11-28)34-25-24(18-30-27(31-25)29-12-9-19-3-4-19)22-6-5-21(17-23(22)26(34)35)33-15-13-32(2)14-16-33/h5-6,17-20,36H,3-4,7-16H2,1-2H3,(H,29,30,31) |
| InChIKey | QJJKGUWWYVTFQP-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 86.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.65 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|