C33H48N6O3 — CID 122695854
tert-butyl N-[4-[3-(butylamino)-8-[(cyclohexylamino)methyl]-6-oxopyrimido[4,5-c]isoquinolin-5-yl]cyclohexyl]carbamate (PubChem CID 122695854) has the molecular formula C33H48N6O3 and a molecular weight of 576.79 g/mol. Its IUPAC name is tert-butyl N-[4-[3-(butylamino)-8-[(cyclohexylamino)methyl]-6-oxopyrimido[4,5-c]isoquinolin-5-yl]cyclohexyl]carbamate.
| Compound Name | tert-butyl N-[4-[3-(butylamino)-8-[(cyclohexylamino)methyl]-6-oxopyrimido[4,5-c]isoquinolin-5-yl]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 122695854 |
| Molecular Formula | C33H48N6O3 |
| Molecular Weight | 576.79 g/mol |
| Exact Mass | 576.38 |
| IUPAC Name | tert-butyl N-[4-[3-(butylamino)-8-[(cyclohexylamino)methyl]-6-oxopyrimido[4,5-c]isoquinolin-5-yl]cyclohexyl]carbamate |
| SMILES | CCCCNc1ncc2c3ccc(CNC4CCCCC4)cc3c(=O)n(C3CCC(NC(=O)OC(C)(C)C)CC3)c2n1 |
| InChI | InChI=1S/C33H48N6O3/c1-5-6-18-34-31-36-21-28-26-17-12-22(20-35-23-10-8-7-9-11-23)19-27(26)30(40)39(29(28)38-31)25-15-13-24(14-16-25)37-32(41)42-33(2,3)4/h12,17,19,21,23-25,35H,5-11,13-16,18,20H2,1-4H3,(H,37,41)(H,34,36,38) |
| InChIKey | LYFMPDACPICQRK-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 110.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.79 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|