C27H40N6 — CID 122686450
5-(4-aminocyclohexyl)-N-butyl-8-[(cyclopentylamino)methyl]-6H-pyrimido[4,5-c]isoquinolin-3-amine (PubChem CID 122686450) has the molecular formula C27H40N6 and a molecular weight of 448.66 g/mol. Its IUPAC name is 5-(4-aminocyclohexyl)-N-butyl-8-[(cyclopentylamino)methyl]-6H-pyrimido[4,5-c]isoquinolin-3-amine.
| Compound Name | 5-(4-aminocyclohexyl)-N-butyl-8-[(cyclopentylamino)methyl]-6H-pyrimido[4,5-c]isoquinolin-3-amine |
|---|---|
| PubChem CID | 122686450 |
| Molecular Formula | C27H40N6 |
| Molecular Weight | 448.66 g/mol |
| Exact Mass | 448.33 |
| IUPAC Name | 5-(4-aminocyclohexyl)-N-butyl-8-[(cyclopentylamino)methyl]-6H-pyrimido[4,5-c]isoquinolin-3-amine |
| SMILES | CCCCNc1ncc2c(n1)N(C1CCC(N)CC1)Cc1cc(CNC3CCCC3)ccc1-2 |
| InChI | InChI=1S/C27H40N6/c1-2-3-14-29-27-31-17-25-24-13-8-19(16-30-22-6-4-5-7-22)15-20(24)18-33(26(25)32-27)23-11-9-21(28)10-12-23/h8,13,15,17,21-23,30H,2-7,9-12,14,16,18,28H2,1H3,(H,29,31,32) |
| InChIKey | DYVVCWFYAKHAJQ-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 79.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.66 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|