C22H28ClN5O2 — CID 122686449
[4-[3-(butylamino)-8-chloro-6H-pyrimido[4,5-c]isoquinolin-5-yl]cyclohexyl]carbamic acid (PubChem CID 122686449) has the molecular formula C22H28ClN5O2 and a molecular weight of 429.95 g/mol. Its IUPAC name is [4-[3-(butylamino)-8-chloro-6H-pyrimido[4,5-c]isoquinolin-5-yl]cyclohexyl]carbamic acid.
| Compound Name | [4-[3-(butylamino)-8-chloro-6H-pyrimido[4,5-c]isoquinolin-5-yl]cyclohexyl]carbamic acid |
|---|---|
| PubChem CID | 122686449 |
| Molecular Formula | C22H28ClN5O2 |
| Molecular Weight | 429.95 g/mol |
| Exact Mass | 429.19 |
| IUPAC Name | [4-[3-(butylamino)-8-chloro-6H-pyrimido[4,5-c]isoquinolin-5-yl]cyclohexyl]carbamic acid |
| SMILES | CCCCNc1ncc2c(n1)N(C1CCC(NC(=O)O)CC1)Cc1cc(Cl)ccc1-2 |
| InChI | InChI=1S/C22H28ClN5O2/c1-2-3-10-24-21-25-12-19-18-9-4-15(23)11-14(18)13-28(20(19)27-21)17-7-5-16(6-8-17)26-22(29)30/h4,9,11-12,16-17,26H,2-3,5-8,10,13H2,1H3,(H,29,30)(H,24,25,27) |
| InChIKey | HWSSQENNCRSGEG-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 90.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.95 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|