C29H34FN7O2 — CID 156703078
benzyl N-[4-[6-(butylamino)-3-(4-fluoroanilino)pyrazolo[3,4-d]pyrimidin-1-yl]cyclohexyl]carbamate (PubChem CID 156703078) has the molecular formula C29H34FN7O2 and a molecular weight of 531.64 g/mol. Its IUPAC name is benzyl N-[4-[6-(butylamino)-3-(4-fluoroanilino)pyrazolo[3,4-d]pyrimidin-1-yl]cyclohexyl]carbamate.
| Compound Name | benzyl N-[4-[6-(butylamino)-3-(4-fluoroanilino)pyrazolo[3,4-d]pyrimidin-1-yl]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 156703078 |
| Molecular Formula | C29H34FN7O2 |
| Molecular Weight | 531.64 g/mol |
| Exact Mass | 531.28 |
| IUPAC Name | benzyl N-[4-[6-(butylamino)-3-(4-fluoroanilino)pyrazolo[3,4-d]pyrimidin-1-yl]cyclohexyl]carbamate |
| SMILES | CCCCNc1ncc2c(Nc3ccc(F)cc3)nn(C3CCC(NC(=O)OCc4ccccc4)CC3)c2n1 |
| InChI | InChI=1S/C29H34FN7O2/c1-2-3-17-31-28-32-18-25-26(33-22-11-9-21(30)10-12-22)36-37(27(25)35-28)24-15-13-23(14-16-24)34-29(38)39-19-20-7-5-4-6-8-20/h4-12,18,23-24H,2-3,13-17,19H2,1H3,(H,33,36)(H,34,38)(H,31,32,35) |
| InChIKey | IFESDBRJXDCBQI-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 105.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.64 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|