C21H35N3O3 — CID 157386360
benzyl N-(4-carbamoylcyclohexyl)carbamate;N,N-diethylethanamine (PubChem CID 157386360) has the molecular formula C21H35N3O3 and a molecular weight of 377.53 g/mol. Its IUPAC name is benzyl N-(4-carbamoylcyclohexyl)carbamate;N,N-diethylethanamine.
| Compound Name | benzyl N-(4-carbamoylcyclohexyl)carbamate;N,N-diethylethanamine |
|---|---|
| PubChem CID | 157386360 |
| Molecular Formula | C21H35N3O3 |
| Molecular Weight | 377.53 g/mol |
| Exact Mass | 377.27 |
| IUPAC Name | benzyl N-(4-carbamoylcyclohexyl)carbamate;N,N-diethylethanamine |
| SMILES | CCN(CC)CC.NC(=O)C1CCC(NC(=O)OCc2ccccc2)CC1 |
| InChI | InChI=1S/C15H20N2O3.C6H15N/c16-14(18)12-6-8-13(9-7-12)17-15(19)20-10-11-4-2-1-3-5-11;1-4-7(5-2)6-3/h1-5,12-13H,6-10H2,(H2,16,18)(H,17,19);4-6H2,1-3H3 |
| InChIKey | BLMCSWXAHPONSI-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.53 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |