C25H25FN4O3 — CID 169102689
benzyl N-[4-[3-(4-cyano-3-fluorophenyl)-5-methoxypyrazol-1-yl]cyclohexyl]carbamate (PubChem CID 169102689) has the molecular formula C25H25FN4O3 and a molecular weight of 448.50 g/mol. Its IUPAC name is benzyl N-[4-[3-(4-cyano-3-fluorophenyl)-5-methoxypyrazol-1-yl]cyclohexyl]carbamate.
| Compound Name | benzyl N-[4-[3-(4-cyano-3-fluorophenyl)-5-methoxypyrazol-1-yl]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 169102689 |
| Molecular Formula | C25H25FN4O3 |
| Molecular Weight | 448.50 g/mol |
| Exact Mass | 448.19 |
| IUPAC Name | benzyl N-[4-[3-(4-cyano-3-fluorophenyl)-5-methoxypyrazol-1-yl]cyclohexyl]carbamate |
| SMILES | COc1cc(-c2ccc(C#N)c(F)c2)nn1C1CCC(NC(=O)OCc2ccccc2)CC1 |
| InChI | InChI=1S/C25H25FN4O3/c1-32-24-14-23(18-7-8-19(15-27)22(26)13-18)29-30(24)21-11-9-20(10-12-21)28-25(31)33-16-17-5-3-2-4-6-17/h2-8,13-14,20-21H,9-12,16H2,1H3,(H,28,31) |
| InChIKey | LYOXQMSCKAUOSF-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 89.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.50 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |