C21H23IN4O3 — CID 90696549
benzyl N-[4-[(5-cyano-3-iodo-6-methoxy-2-pyridinyl)amino]cyclohexyl]carbamate (PubChem CID 90696549) has the molecular formula C21H23IN4O3 and a molecular weight of 506.34 g/mol. Its IUPAC name is benzyl N-[4-[(5-cyano-3-iodo-6-methoxy-2-pyridinyl)amino]cyclohexyl]carbamate.
| Compound Name | benzyl N-[4-[(5-cyano-3-iodo-6-methoxy-2-pyridinyl)amino]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 90696549 |
| Molecular Formula | C21H23IN4O3 |
| Molecular Weight | 506.34 g/mol |
| Exact Mass | 506.08 |
| IUPAC Name | benzyl N-[4-[(5-cyano-3-iodo-6-methoxy-2-pyridinyl)amino]cyclohexyl]carbamate |
| SMILES | COc1nc(NC2CCC(NC(=O)OCc3ccccc3)CC2)c(I)cc1C#N |
| InChI | InChI=1S/C21H23IN4O3/c1-28-20-15(12-23)11-18(22)19(26-20)24-16-7-9-17(10-8-16)25-21(27)29-13-14-5-3-2-4-6-14/h2-6,11,16-17H,7-10,13H2,1H3,(H,24,26)(H,25,27) |
| InChIKey | FARBTYXWPPNRMH-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 96.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.34 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|