C28H39N5O2 — CID 122695859
3-(butylamino)-5-[4-[1-[(2-methylpropan-2-yl)oxy]ethenylamino]cyclohexyl]-6H-pyrimido[4,5-c]isoquinoline-8-carbaldehyde (PubChem CID 122695859) has the molecular formula C28H39N5O2 and a molecular weight of 477.65 g/mol. Its IUPAC name is 3-(butylamino)-5-[4-[1-[(2-methylpropan-2-yl)oxy]ethenylamino]cyclohexyl]-6H-pyrimido[4,5-c]isoquinoline-8-carbaldehyde.
| Compound Name | 3-(butylamino)-5-[4-[1-[(2-methylpropan-2-yl)oxy]ethenylamino]cyclohexyl]-6H-pyrimido[4,5-c]isoquinoline-8-carbaldehyde |
|---|---|
| PubChem CID | 122695859 |
| Molecular Formula | C28H39N5O2 |
| Molecular Weight | 477.65 g/mol |
| Exact Mass | 477.31 |
| IUPAC Name | 3-(butylamino)-5-[4-[1-[(2-methylpropan-2-yl)oxy]ethenylamino]cyclohexyl]-6H-pyrimido[4,5-c]isoquinoline-8-carbaldehyde |
| SMILES | C=C(NC1CCC(N2Cc3cc(C=O)ccc3-c3cnc(NCCCC)nc32)CC1)OC(C)(C)C |
| InChI | InChI=1S/C28H39N5O2/c1-6-7-14-29-27-30-16-25-24-13-8-20(18-34)15-21(24)17-33(26(25)32-27)23-11-9-22(10-12-23)31-19(2)35-28(3,4)5/h8,13,15-16,18,22-23,31H,2,6-7,9-12,14,17H2,1,3-5H3,(H,29,30,32) |
| InChIKey | OBFOOWDKPHHKHM-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.65 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|