C29H40N4O2 — CID 153017691
tert-butyl 2-[4-[3-(butylamino)-8-ethenyl-6H-pyrimido[4,5-c]isoquinolin-5-yl]cyclohexyl]acetate (PubChem CID 153017691) has the molecular formula C29H40N4O2 and a molecular weight of 476.67 g/mol. Its IUPAC name is tert-butyl 2-[4-[3-(butylamino)-8-ethenyl-6H-pyrimido[4,5-c]isoquinolin-5-yl]cyclohexyl]acetate.
| Compound Name | tert-butyl 2-[4-[3-(butylamino)-8-ethenyl-6H-pyrimido[4,5-c]isoquinolin-5-yl]cyclohexyl]acetate |
|---|---|
| PubChem CID | 153017691 |
| Molecular Formula | C29H40N4O2 |
| Molecular Weight | 476.67 g/mol |
| Exact Mass | 476.32 |
| IUPAC Name | tert-butyl 2-[4-[3-(butylamino)-8-ethenyl-6H-pyrimido[4,5-c]isoquinolin-5-yl]cyclohexyl]acetate |
| SMILES | C=Cc1ccc2c(c1)CN(C1CCC(CC(=O)OC(C)(C)C)CC1)c1nc(NCCCC)ncc1-2 |
| InChI | InChI=1S/C29H40N4O2/c1-6-8-15-30-28-31-18-25-24-14-11-20(7-2)16-22(24)19-33(27(25)32-28)23-12-9-21(10-13-23)17-26(34)35-29(3,4)5/h7,11,14,16,18,21,23H,2,6,8-10,12-13,15,17,19H2,1,3-5H3,(H,30,31,32) |
| InChIKey | VBHSBMFOKQVCRN-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.67 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|