C30H46N4 — CID 145187251
N-[[4-[(Z)-1-(butylamino)ethenyliminomethyl]-2-cyclohexyl-3-methyl-1H-isoquinolin-7-yl]methyl]cyclohexanamine (PubChem CID 145187251) has the molecular formula C30H46N4 and a molecular weight of 462.73 g/mol. Its IUPAC name is N-[[4-[(Z)-1-(butylamino)ethenyliminomethyl]-2-cyclohexyl-3-methyl-1H-isoquinolin-7-yl]methyl]cyclohexanamine.
| Compound Name | N-[[4-[(Z)-1-(butylamino)ethenyliminomethyl]-2-cyclohexyl-3-methyl-1H-isoquinolin-7-yl]methyl]cyclohexanamine |
|---|---|
| PubChem CID | 145187251 |
| Molecular Formula | C30H46N4 |
| Molecular Weight | 462.73 g/mol |
| Exact Mass | 462.37 |
| IUPAC Name | N-[[4-[(Z)-1-(butylamino)ethenyliminomethyl]-2-cyclohexyl-3-methyl-1H-isoquinolin-7-yl]methyl]cyclohexanamine |
| SMILES | C=C(/N=C\C1=C(C)N(C2CCCCC2)Cc2cc(CNC3CCCCC3)ccc21)NCCCC |
| InChI | InChI=1S/C30H46N4/c1-4-5-18-31-24(3)32-21-30-23(2)34(28-14-10-7-11-15-28)22-26-19-25(16-17-29(26)30)20-33-27-12-8-6-9-13-27/h16-17,19,21,27-28,31,33H,3-15,18,20,22H2,1-2H3/b32-21- |
| InChIKey | QHZIKYLMBPEGBU-QXPFVDMISA-N |
| XLogP | 6.92 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.73 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|