C13H18N2 — CID 103998248
N-(2,3-dihydro-1H-isoindol-5-ylmethyl)cyclobutanamine (PubChem CID 103998248) has the molecular formula C13H18N2 and a molecular weight of 202.30 g/mol. Its IUPAC name is N-(2,3-dihydro-1H-isoindol-5-ylmethyl)cyclobutanamine.
| Compound Name | N-(2,3-dihydro-1H-isoindol-5-ylmethyl)cyclobutanamine |
|---|---|
| PubChem CID | 103998248 |
| Molecular Formula | C13H18N2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.15 |
| IUPAC Name | N-(2,3-dihydro-1H-isoindol-5-ylmethyl)cyclobutanamine |
| SMILES | c1cc2c(cc1CNC1CCC1)CNC2 |
| InChI | InChI=1S/C13H18N2/c1-2-13(3-1)15-7-10-4-5-11-8-14-9-12(11)6-10/h4-6,13-15H,1-3,7-9H2 |
| InChIKey | YWAMRWRTMZQBQZ-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |