C11H15NO — CID 62416890
3-[(cyclobutylamino)methyl]phenol (PubChem CID 62416890) has the molecular formula C11H15NO and a molecular weight of 177.25 g/mol. Its IUPAC name is 3-[(cyclobutylamino)methyl]phenol.
| Compound Name | 3-[(cyclobutylamino)methyl]phenol |
|---|---|
| PubChem CID | 62416890 |
| Molecular Formula | C11H15NO |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.12 |
| IUPAC Name | 3-[(cyclobutylamino)methyl]phenol |
| SMILES | Oc1cccc(CNC2CCC2)c1 |
| InChI | InChI=1S/C11H15NO/c13-11-6-1-3-9(7-11)8-12-10-4-2-5-10/h1,3,6-7,10,12-13H,2,4-5,8H2 |
| InChIKey | OMAGUNGITIABOC-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |