C13H18ClNO — CID 106364946
3-[[[2-(chloromethyl)cyclopentyl]amino]methyl]phenol (PubChem CID 106364946) has the molecular formula C13H18ClNO and a molecular weight of 239.75 g/mol. Its IUPAC name is 3-[[[2-(chloromethyl)cyclopentyl]amino]methyl]phenol.
| Compound Name | 3-[[[2-(chloromethyl)cyclopentyl]amino]methyl]phenol |
|---|---|
| PubChem CID | 106364946 |
| Molecular Formula | C13H18ClNO |
| Molecular Weight | 239.75 g/mol |
| Exact Mass | 239.11 |
| IUPAC Name | 3-[[[2-(chloromethyl)cyclopentyl]amino]methyl]phenol |
| SMILES | Oc1cccc(CNC2CCCC2CCl)c1 |
| InChI | InChI=1S/C13H18ClNO/c14-8-11-4-2-6-13(11)15-9-10-3-1-5-12(16)7-10/h1,3,5,7,11,13,15-16H,2,4,6,8-9H2 |
| InChIKey | KYYWZHIRHYQIHN-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.75 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|