C25H33FN6O — CID 144944042
N-butyl-1-cyclohexyl-3-(3-fluoro-4-morpholin-4-ylphenyl)pyrazolo[3,4-d]pyrimidin-6-amine (PubChem CID 144944042) has the molecular formula C25H33FN6O and a molecular weight of 452.58 g/mol. Its IUPAC name is N-butyl-1-cyclohexyl-3-(3-fluoro-4-morpholin-4-ylphenyl)pyrazolo[3,4-d]pyrimidin-6-amine.
| Compound Name | N-butyl-1-cyclohexyl-3-(3-fluoro-4-morpholin-4-ylphenyl)pyrazolo[3,4-d]pyrimidin-6-amine |
|---|---|
| PubChem CID | 144944042 |
| Molecular Formula | C25H33FN6O |
| Molecular Weight | 452.58 g/mol |
| Exact Mass | 452.27 |
| IUPAC Name | N-butyl-1-cyclohexyl-3-(3-fluoro-4-morpholin-4-ylphenyl)pyrazolo[3,4-d]pyrimidin-6-amine |
| SMILES | CCCCNc1ncc2c(-c3ccc(N4CCOCC4)c(F)c3)nn(C3CCCCC3)c2n1 |
| InChI | InChI=1S/C25H33FN6O/c1-2-3-11-27-25-28-17-20-23(30-32(24(20)29-25)19-7-5-4-6-8-19)18-9-10-22(21(26)16-18)31-12-14-33-15-13-31/h9-10,16-17,19H,2-8,11-15H2,1H3,(H,27,28,29) |
| InChIKey | RFCWWPSVJBBIEO-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 68.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.58 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|