C29H43N7O — CID 166023851
4-[6-(butylamino)-3-[4-[(4-propan-2-ylpiperazin-1-yl)methyl]phenyl]pyrazolo[3,4-d]pyrimidin-1-yl]cyclohexan-1-ol (PubChem CID 166023851) has the molecular formula C29H43N7O and a molecular weight of 505.71 g/mol. Its IUPAC name is 4-[6-(butylamino)-3-[4-[(4-propan-2-ylpiperazin-1-yl)methyl]phenyl]pyrazolo[3,4-d]pyrimidin-1-yl]cyclohexan-1-ol.
| Compound Name | 4-[6-(butylamino)-3-[4-[(4-propan-2-ylpiperazin-1-yl)methyl]phenyl]pyrazolo[3,4-d]pyrimidin-1-yl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 166023851 |
| Molecular Formula | C29H43N7O |
| Molecular Weight | 505.71 g/mol |
| Exact Mass | 505.35 |
| IUPAC Name | 4-[6-(butylamino)-3-[4-[(4-propan-2-ylpiperazin-1-yl)methyl]phenyl]pyrazolo[3,4-d]pyrimidin-1-yl]cyclohexan-1-ol |
| SMILES | CCCCNc1ncc2c(-c3ccc(CN4CCN(C(C)C)CC4)cc3)nn(C3CCC(O)CC3)c2n1 |
| InChI | InChI=1S/C29H43N7O/c1-4-5-14-30-29-31-19-26-27(33-36(28(26)32-29)24-10-12-25(37)13-11-24)23-8-6-22(7-9-23)20-34-15-17-35(18-16-34)21(2)3/h6-9,19,21,24-25,37H,4-5,10-18,20H2,1-3H3,(H,30,31,32) |
| InChIKey | INONKTYJZZTKSK-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 82.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.71 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|