C27H42N6 — CID 144943977
N-butyl-5-[4-[(4-propan-2-yl-1,4-diazepan-1-yl)methyl]phenyl]-7H-pyrrolo[2,3-d]pyrimidin-2-amine;ethane (PubChem CID 144943977) has the molecular formula C27H42N6 and a molecular weight of 450.68 g/mol. Its IUPAC name is N-butyl-5-[4-[(4-propan-2-yl-1,4-diazepan-1-yl)methyl]phenyl]-7H-pyrrolo[2,3-d]pyrimidin-2-amine;ethane.
| Compound Name | N-butyl-5-[4-[(4-propan-2-yl-1,4-diazepan-1-yl)methyl]phenyl]-7H-pyrrolo[2,3-d]pyrimidin-2-amine;ethane |
|---|---|
| PubChem CID | 144943977 |
| Molecular Formula | C27H42N6 |
| Molecular Weight | 450.68 g/mol |
| Exact Mass | 450.35 |
| IUPAC Name | N-butyl-5-[4-[(4-propan-2-yl-1,4-diazepan-1-yl)methyl]phenyl]-7H-pyrrolo[2,3-d]pyrimidin-2-amine;ethane |
| SMILES | CC.CCCCNc1ncc2c(-c3ccc(CN4CCCN(C(C)C)CC4)cc3)c[nH]c2n1 |
| InChI | InChI=1S/C25H36N6.C2H6/c1-4-5-11-26-25-28-17-23-22(16-27-24(23)29-25)21-9-7-20(8-10-21)18-30-12-6-13-31(15-14-30)19(2)3;1-2/h7-10,16-17,19H,4-6,11-15,18H2,1-3H3,(H2,26,27,28,29);1-2H3 |
| InChIKey | KCDYIHPCYNQSGW-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 60.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.68 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|