C29H42N6O3S — CID 166023969
4-[2-(butylamino)-5-[4-(4-propan-2-ylpiperazin-1-yl)sulfonylphenyl]pyrrolo[2,3-d]pyrimidin-7-yl]cyclohexan-1-ol (PubChem CID 166023969) has the molecular formula C29H42N6O3S and a molecular weight of 554.76 g/mol. Its IUPAC name is 4-[2-(butylamino)-5-[4-(4-propan-2-ylpiperazin-1-yl)sulfonylphenyl]pyrrolo[2,3-d]pyrimidin-7-yl]cyclohexan-1-ol.
| Compound Name | 4-[2-(butylamino)-5-[4-(4-propan-2-ylpiperazin-1-yl)sulfonylphenyl]pyrrolo[2,3-d]pyrimidin-7-yl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 166023969 |
| Molecular Formula | C29H42N6O3S |
| Molecular Weight | 554.76 g/mol |
| Exact Mass | 554.30 |
| IUPAC Name | 4-[2-(butylamino)-5-[4-(4-propan-2-ylpiperazin-1-yl)sulfonylphenyl]pyrrolo[2,3-d]pyrimidin-7-yl]cyclohexan-1-ol |
| SMILES | CCCCNc1ncc2c(-c3ccc(S(=O)(=O)N4CCN(C(C)C)CC4)cc3)cn(C3CCC(O)CC3)c2n1 |
| InChI | InChI=1S/C29H42N6O3S/c1-4-5-14-30-29-31-19-26-27(20-35(28(26)32-29)23-8-10-24(36)11-9-23)22-6-12-25(13-7-22)39(37,38)34-17-15-33(16-18-34)21(2)3/h6-7,12-13,19-21,23-24,36H,4-5,8-11,14-18H2,1-3H3,(H,30,31,32) |
| InChIKey | CSVKICVFFJVDFR-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 103.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.76 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|