C22H35N5O — CID 169495040
4-[2-(pentylamino)-5-piperidin-4-ylpyrrolo[2,3-d]pyrimidin-7-yl]cyclohexan-1-ol (PubChem CID 169495040) has the molecular formula C22H35N5O and a molecular weight of 385.56 g/mol. Its IUPAC name is 4-[2-(pentylamino)-5-piperidin-4-ylpyrrolo[2,3-d]pyrimidin-7-yl]cyclohexan-1-ol.
| Compound Name | 4-[2-(pentylamino)-5-piperidin-4-ylpyrrolo[2,3-d]pyrimidin-7-yl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 169495040 |
| Molecular Formula | C22H35N5O |
| Molecular Weight | 385.56 g/mol |
| Exact Mass | 385.28 |
| IUPAC Name | 4-[2-(pentylamino)-5-piperidin-4-ylpyrrolo[2,3-d]pyrimidin-7-yl]cyclohexan-1-ol |
| SMILES | CCCCCNc1ncc2c(C3CCNCC3)cn(C3CCC(O)CC3)c2n1 |
| InChI | InChI=1S/C22H35N5O/c1-2-3-4-11-24-22-25-14-19-20(16-9-12-23-13-10-16)15-27(21(19)26-22)17-5-7-18(28)8-6-17/h14-18,23,28H,2-13H2,1H3,(H,24,25,26) |
| InChIKey | HFVAVEAJDNBIRI-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 75.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.56 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|