C28H40N6O — CID 118446459
4-[5-[4-(azepan-4-ylamino)phenyl]-2-(butylamino)pyrrolo[2,3-d]pyrimidin-7-yl]cyclohexan-1-ol (PubChem CID 118446459) has the molecular formula C28H40N6O and a molecular weight of 476.67 g/mol. Its IUPAC name is 4-[5-[4-(azepan-4-ylamino)phenyl]-2-(butylamino)pyrrolo[2,3-d]pyrimidin-7-yl]cyclohexan-1-ol.
| Compound Name | 4-[5-[4-(azepan-4-ylamino)phenyl]-2-(butylamino)pyrrolo[2,3-d]pyrimidin-7-yl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 118446459 |
| Molecular Formula | C28H40N6O |
| Molecular Weight | 476.67 g/mol |
| Exact Mass | 476.33 |
| IUPAC Name | 4-[5-[4-(azepan-4-ylamino)phenyl]-2-(butylamino)pyrrolo[2,3-d]pyrimidin-7-yl]cyclohexan-1-ol |
| SMILES | CCCCNc1ncc2c(-c3ccc(NC4CCCNCC4)cc3)cn(C3CCC(O)CC3)c2n1 |
| InChI | InChI=1S/C28H40N6O/c1-2-3-16-30-28-31-18-25-26(19-34(27(25)33-28)23-10-12-24(35)13-11-23)20-6-8-22(9-7-20)32-21-5-4-15-29-17-14-21/h6-9,18-19,21,23-24,29,32,35H,2-5,10-17H2,1H3,(H,30,31,33) |
| InChIKey | KMDUVZLDXOHFPQ-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 87.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.67 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|