C29H35N5O — CID 163766649
4-[[5-(4-anilinophenyl)-2-(butylamino)pyrrolo[2,3-d]pyrimidin-7-yl]methyl]cyclohexan-1-ol (PubChem CID 163766649) has the molecular formula C29H35N5O and a molecular weight of 469.63 g/mol. Its IUPAC name is 4-[[5-(4-anilinophenyl)-2-(butylamino)pyrrolo[2,3-d]pyrimidin-7-yl]methyl]cyclohexan-1-ol.
| Compound Name | 4-[[5-(4-anilinophenyl)-2-(butylamino)pyrrolo[2,3-d]pyrimidin-7-yl]methyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 163766649 |
| Molecular Formula | C29H35N5O |
| Molecular Weight | 469.63 g/mol |
| Exact Mass | 469.28 |
| IUPAC Name | 4-[[5-(4-anilinophenyl)-2-(butylamino)pyrrolo[2,3-d]pyrimidin-7-yl]methyl]cyclohexan-1-ol |
| SMILES | CCCCNc1ncc2c(-c3ccc(Nc4ccccc4)cc3)cn(CC3CCC(O)CC3)c2n1 |
| InChI | InChI=1S/C29H35N5O/c1-2-3-17-30-29-31-18-26-27(20-34(28(26)33-29)19-21-9-15-25(35)16-10-21)22-11-13-24(14-12-22)32-23-7-5-4-6-8-23/h4-8,11-14,18,20-21,25,32,35H,2-3,9-10,15-17,19H2,1H3,(H,30,31,33) |
| InChIKey | MCWCRRXBQYKJPU-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 75.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.63 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|