C20H26F2N6O — CID 142512704
7-cyclohexyl-N-[2-(difluoromethoxy)ethyl]-5-(1-ethylpyrazol-4-yl)pyrrolo[2,3-d]pyrimidin-2-amine (PubChem CID 142512704) has the molecular formula C20H26F2N6O and a molecular weight of 404.47 g/mol. Its IUPAC name is 7-cyclohexyl-N-[2-(difluoromethoxy)ethyl]-5-(1-ethylpyrazol-4-yl)pyrrolo[2,3-d]pyrimidin-2-amine.
| Compound Name | 7-cyclohexyl-N-[2-(difluoromethoxy)ethyl]-5-(1-ethylpyrazol-4-yl)pyrrolo[2,3-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 142512704 |
| Molecular Formula | C20H26F2N6O |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.21 |
| IUPAC Name | 7-cyclohexyl-N-[2-(difluoromethoxy)ethyl]-5-(1-ethylpyrazol-4-yl)pyrrolo[2,3-d]pyrimidin-2-amine |
| SMILES | CCn1cc(-c2cn(C3CCCCC3)c3nc(NCCOC(F)F)ncc23)cn1 |
| InChI | InChI=1S/C20H26F2N6O/c1-2-27-12-14(10-25-27)17-13-28(15-6-4-3-5-7-15)18-16(17)11-24-20(26-18)23-8-9-29-19(21)22/h10-13,15,19H,2-9H2,1H3,(H,23,24,26) |
| InChIKey | CBHQDOJISFAXBL-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 69.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|