C21H23F3N4O — CID 137399128
7-cyclohexyl-N-[2-(difluoromethoxy)ethyl]-5-(4-fluorophenyl)pyrrolo[2,3-d]pyrimidin-2-amine (PubChem CID 137399128) has the molecular formula C21H23F3N4O and a molecular weight of 404.44 g/mol. Its IUPAC name is 7-cyclohexyl-N-[2-(difluoromethoxy)ethyl]-5-(4-fluorophenyl)pyrrolo[2,3-d]pyrimidin-2-amine.
| Compound Name | 7-cyclohexyl-N-[2-(difluoromethoxy)ethyl]-5-(4-fluorophenyl)pyrrolo[2,3-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 137399128 |
| Molecular Formula | C21H23F3N4O |
| Molecular Weight | 404.44 g/mol |
| Exact Mass | 404.18 |
| IUPAC Name | 7-cyclohexyl-N-[2-(difluoromethoxy)ethyl]-5-(4-fluorophenyl)pyrrolo[2,3-d]pyrimidin-2-amine |
| SMILES | Fc1ccc(-c2cn(C3CCCCC3)c3nc(NCCOC(F)F)ncc23)cc1 |
| InChI | InChI=1S/C21H23F3N4O/c22-15-8-6-14(7-9-15)18-13-28(16-4-2-1-3-5-16)19-17(18)12-26-21(27-19)25-10-11-29-20(23)24/h6-9,12-13,16,20H,1-5,10-11H2,(H,25,26,27) |
| InChIKey | OBCQUABUVARMPB-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.44 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|