C24H27FN6O — CID 24746385
4-[7-[(dimethylamino)methyl]-2-(4-fluorophenyl)imidazo[1,2-a]pyridin-3-yl]-N-(3-methoxypropyl)pyrimidin-2-amine (PubChem CID 24746385) has the molecular formula C24H27FN6O and a molecular weight of 434.52 g/mol. Its IUPAC name is 4-[7-[(dimethylamino)methyl]-2-(4-fluorophenyl)imidazo[1,2-a]pyridin-3-yl]-N-(3-methoxypropyl)pyrimidin-2-amine.
| Compound Name | 4-[7-[(dimethylamino)methyl]-2-(4-fluorophenyl)imidazo[1,2-a]pyridin-3-yl]-N-(3-methoxypropyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 24746385 |
| Molecular Formula | C24H27FN6O |
| Molecular Weight | 434.52 g/mol |
| Exact Mass | 434.22 |
| IUPAC Name | 4-[7-[(dimethylamino)methyl]-2-(4-fluorophenyl)imidazo[1,2-a]pyridin-3-yl]-N-(3-methoxypropyl)pyrimidin-2-amine |
| SMILES | COCCCNc1nccc(-c2c(-c3ccc(F)cc3)nc3cc(CN(C)C)ccn23)n1 |
| InChI | InChI=1S/C24H27FN6O/c1-30(2)16-17-10-13-31-21(15-17)29-22(18-5-7-19(25)8-6-18)23(31)20-9-12-27-24(28-20)26-11-4-14-32-3/h5-10,12-13,15H,4,11,14,16H2,1-3H3,(H,26,27,28) |
| InChIKey | XZIFPNGYBYCPEQ-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 67.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.52 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|