C22H32N4O2 — CID 142517752
2-(butylamino)-8-cyclohexyl-6-(oxan-4-yl)pyrido[4,3-d]pyrimidin-5-one (PubChem CID 142517752) has the molecular formula C22H32N4O2 and a molecular weight of 384.52 g/mol. Its IUPAC name is 2-(butylamino)-8-cyclohexyl-6-(oxan-4-yl)pyrido[4,3-d]pyrimidin-5-one.
| Compound Name | 2-(butylamino)-8-cyclohexyl-6-(oxan-4-yl)pyrido[4,3-d]pyrimidin-5-one |
|---|---|
| PubChem CID | 142517752 |
| Molecular Formula | C22H32N4O2 |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.25 |
| IUPAC Name | 2-(butylamino)-8-cyclohexyl-6-(oxan-4-yl)pyrido[4,3-d]pyrimidin-5-one |
| SMILES | CCCCNc1ncc2c(=O)n(C3CCOCC3)cc(C3CCCCC3)c2n1 |
| InChI | InChI=1S/C22H32N4O2/c1-2-3-11-23-22-24-14-18-20(25-22)19(16-7-5-4-6-8-16)15-26(21(18)27)17-9-12-28-13-10-17/h14-17H,2-13H2,1H3,(H,23,24,25) |
| InChIKey | DGDKFHVNOCXSOZ-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|